3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid

C13H18O3 — CID 82286918

IUPAC3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid
SMILESCCOc1ccccc1CC(C)(C)C(=O)O
InChIInChI=1S/C13H18O3/c1-4-16-11-8-6-5-7-10(11)9-13(2,3)12(14)15/h5-8H,4,9H2,1-3H3,(H,14,15)
InChIKeyWMDYWCVNFNVROQ-UHFFFAOYSA-N
MW222.28 g/mol
LogP2.74
Rot. Bonds5

About 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid

3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid (PubChem CID 82286918) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid
PubChem CID82286918
Molecular FormulaC13H18O3
Molecular Weight222.28 g/mol
Exact Mass222.13
IUPAC Name3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid
SMILESCCOc1ccccc1CC(C)(C)C(=O)O
InChIInChI=1S/C13H18O3/c1-4-16-11-8-6-5-7-10(11)9-13(2,3)12(14)15/h5-8H,4,9H2,1-3H3,(H,14,15)
InChIKeyWMDYWCVNFNVROQ-UHFFFAOYSA-N
XLogP2.74
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.28
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid (CID 82286918) is 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid is CCOc1ccccc1CC(C)(C)C(=O)O.
What is the InChIKey of 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid?
The InChIKey is WMDYWCVNFNVROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-4-16-11-8-6-5-7-10(11)9-13(2,3)12(14)15/h5-8H,4,9H2,1-3H3,(H,14,15).
What are the key properties of 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid?
3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid has a molecular weight of 222.28 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethoxyphenyl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 82286918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).