About 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine
2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine (PubChem CID 82287155) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine.
Molecular Properties
| Compound Name | 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine |
| PubChem CID | 82287155 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine |
| SMILES | CC1(C)COC(Cc2ccccc2F)CN1 |
| InChI | InChI=1S/C13H18FNO/c1-13(2)9-16-11(8-15-13)7-10-5-3-4-6-12(10)14/h3-6,11,15H,7-9H2,1-2H3 |
| InChIKey | UQIAYVIUOVFMIR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine?
The IUPAC name of 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine (CID 82287155) is 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine.
What is the SMILES notation for 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine?
The canonical SMILES for 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine is CC1(C)COC(Cc2ccccc2F)CN1.
What is the InChIKey of 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine?
The InChIKey is UQIAYVIUOVFMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO/c1-13(2)9-16-11(8-15-13)7-10-5-3-4-6-12(10)14/h3-6,11,15H,7-9H2,1-2H3.
What are the key properties of 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine?
2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine has a molecular weight of 223.29 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-fluorophenyl)methyl]-5,5-dimethylmorpholine is sourced from PubChem (CID 82287155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).