C12H17NOS — CID 82287244
3-[(3-methylphenoxy)methyl]thiomorpholine (PubChem CID 82287244) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-[(3-methylphenoxy)methyl]thiomorpholine.
| Compound Name | 3-[(3-methylphenoxy)methyl]thiomorpholine |
|---|---|
| PubChem CID | 82287244 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-[(3-methylphenoxy)methyl]thiomorpholine |
| SMILES | Cc1cccc(OCC2CSCCN2)c1 |
| InChI | InChI=1S/C12H17NOS/c1-10-3-2-4-12(7-10)14-8-11-9-15-6-5-13-11/h2-4,7,11,13H,5-6,8-9H2,1H3 |
| InChIKey | JJNOQTTWNPZAGI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |