About 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole
2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole (PubChem CID 82287889) has the molecular formula C11H12ClFN2
and a molecular weight of 226.68 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 82287889 |
| Molecular Formula | C11H12ClFN2 |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole |
| SMILES | Fc1cccc(Cl)c1CCC1=NCCN1 |
| InChI | InChI=1S/C11H12ClFN2/c12-9-2-1-3-10(13)8(9)4-5-11-14-6-7-15-11/h1-3H,4-7H2,(H,14,15) |
| InChIKey | QSGYCNLUWOJDKA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole (CID 82287889) is 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole is Fc1cccc(Cl)c1CCC1=NCCN1.
What is the InChIKey of 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole?
The InChIKey is QSGYCNLUWOJDKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClFN2/c12-9-2-1-3-10(13)8(9)4-5-11-14-6-7-15-11/h1-3H,4-7H2,(H,14,15).
What are the key properties of 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole?
2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole has a molecular weight of 226.68 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-chloro-6-fluorophenyl)ethyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 82287889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).