C13H14N2O2 — CID 82288733
2-[2-(4-ethylphenyl)-1H-imidazol-5-yl]acetic acid (PubChem CID 82288733) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-[2-(4-ethylphenyl)-1H-imidazol-5-yl]acetic acid.
| Compound Name | 2-[2-(4-ethylphenyl)-1H-imidazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 82288733 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-[2-(4-ethylphenyl)-1H-imidazol-5-yl]acetic acid |
| SMILES | CCc1ccc(-c2ncc(CC(=O)O)[nH]2)cc1 |
| InChI | InChI=1S/C13H14N2O2/c1-2-9-3-5-10(6-4-9)13-14-8-11(15-13)7-12(16)17/h3-6,8H,2,7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | NSIUEXRPZMBFLJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |