C12H10N2OS — CID 82288857
2-pyridin-4-yl-5,7-dihydro-4H-1,3-benzothiazol-6-one (PubChem CID 82288857) has the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-pyridin-4-yl-5,7-dihydro-4H-1,3-benzothiazol-6-one.
| Compound Name | 2-pyridin-4-yl-5,7-dihydro-4H-1,3-benzothiazol-6-one |
|---|---|
| PubChem CID | 82288857 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-pyridin-4-yl-5,7-dihydro-4H-1,3-benzothiazol-6-one |
| SMILES | O=C1CCc2nc(-c3ccncc3)sc2C1 |
| InChI | InChI=1S/C12H10N2OS/c15-9-1-2-10-11(7-9)16-12(14-10)8-3-5-13-6-4-8/h3-6H,1-2,7H2 |
| InChIKey | VJCBVVNCTALWHY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |