C12H13N3S — CID 82289305
6-pyridin-3-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 82289305) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 6-pyridin-3-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | 6-pyridin-3-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82289305 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 6-pyridin-3-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(s1)CC(c1cccnc1)CC2 |
| InChI | InChI=1S/C12H13N3S/c13-12-15-10-4-3-8(6-11(10)16-12)9-2-1-5-14-7-9/h1-2,5,7-8H,3-4,6H2,(H2,13,15) |
| InChIKey | IQIBQNMUTXLQKV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |