C12H10FNO3 — CID 82291027
2-[2-(3-fluorophenyl)ethyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 82291027) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[2-(3-fluorophenyl)ethyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82291027 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(CCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C12H10FNO3/c13-9-3-1-2-8(6-9)4-5-11-14-10(7-17-11)12(15)16/h1-3,6-7H,4-5H2,(H,15,16) |
| InChIKey | UPCJPXGJUNPKKB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |