About N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide
N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide (PubChem CID 822914) has the molecular formula C21H25NO3
and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide.
Molecular Properties
| Compound Name | N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide |
| PubChem CID | 822914 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide |
| SMILES | COc1ccc(C2(CNC(=O)c3ccccc3)CCCC2)cc1OC |
| InChI | InChI=1S/C21H25NO3/c1-24-18-11-10-17(14-19(18)25-2)21(12-6-7-13-21)15-22-20(23)16-8-4-3-5-9-16/h3-5,8-11,14H,6-7,12-13,15H2,1-2H3,(H,22,23) |
| InChIKey | SMMHUAXSCQRSQN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide?
The IUPAC name of N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide (CID 822914) is N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide.
What is the SMILES notation for N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide?
The canonical SMILES for N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide is COc1ccc(C2(CNC(=O)c3ccccc3)CCCC2)cc1OC.
What is the InChIKey of N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide?
The InChIKey is SMMHUAXSCQRSQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3/c1-24-18-11-10-17(14-19(18)25-2)21(12-6-7-13-21)15-22-20(23)16-8-4-3-5-9-16/h3-5,8-11,14H,6-7,12-13,15H2,1-2H3,(H,22,23).
What are the key properties of N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide?
N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide has a molecular weight of 339.44 g/mol, XLogP of 3.95, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]benzamide is sourced from PubChem (CID 822914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).