C19H14O2 — CID 822916
2-(4-methoxyphenyl)indeno[2,1-b]pyran (PubChem CID 822916) has the molecular formula C19H14O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)indeno[2,1-b]pyran.
| Compound Name | 2-(4-methoxyphenyl)indeno[2,1-b]pyran |
|---|---|
| PubChem CID | 822916 |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(4-methoxyphenyl)indeno[2,1-b]pyran |
| SMILES | COc1ccc(-c2ccc3c4ccccc4cc-3o2)cc1 |
| InChI | InChI=1S/C19H14O2/c1-20-15-8-6-13(7-9-15)18-11-10-17-16-5-3-2-4-14(16)12-19(17)21-18/h2-12H,1H3 |
| InChIKey | KDQWMBXHQRGXPL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |