C11H12FN3S — CID 82291885
5-[2-(4-fluorophenyl)propyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82291885) has the molecular formula C11H12FN3S and a molecular weight of 237.30 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)propyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[2-(4-fluorophenyl)propyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82291885 |
| Molecular Formula | C11H12FN3S |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 5-[2-(4-fluorophenyl)propyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CC(Cc1nc(=S)[nH][nH]1)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FN3S/c1-7(6-10-13-11(16)15-14-10)8-2-4-9(12)5-3-8/h2-5,7H,6H2,1H3,(H2,13,14,15,16) |
| InChIKey | HJGLUZXIEACRII-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|