5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride

C8H8ClFO3S — CID 82292286

IUPAC5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride
SMILESCOc1cc(C)c(S(=O)(=O)F)cc1Cl
InChIInChI=1S/C8H8ClFO3S/c1-5-3-7(13-2)6(9)4-8(5)14(10,11)12/h3-4H,1-2H3
InChIKeyFJQUAULTSNRRQN-UHFFFAOYSA-N
MW238.67 g/mol
LogP2.32
Rot. Bonds2

About 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride

5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride (PubChem CID 82292286) has the molecular formula C8H8ClFO3S and a molecular weight of 238.67 g/mol. Its IUPAC name is 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride.

Molecular Properties

Compound Name5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride
PubChem CID82292286
Molecular FormulaC8H8ClFO3S
Molecular Weight238.67 g/mol
Exact Mass237.99
IUPAC Name5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride
SMILESCOc1cc(C)c(S(=O)(=O)F)cc1Cl
InChIInChI=1S/C8H8ClFO3S/c1-5-3-7(13-2)6(9)4-8(5)14(10,11)12/h3-4H,1-2H3
InChIKeyFJQUAULTSNRRQN-UHFFFAOYSA-N
XLogP2.32
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.67
LogP ≤ 52.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride?
The IUPAC name of 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride (CID 82292286) is 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride.
What is the SMILES notation for 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride?
The canonical SMILES for 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride is COc1cc(C)c(S(=O)(=O)F)cc1Cl.
What is the InChIKey of 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride?
The InChIKey is FJQUAULTSNRRQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClFO3S/c1-5-3-7(13-2)6(9)4-8(5)14(10,11)12/h3-4H,1-2H3.
What are the key properties of 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride?
5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride has a molecular weight of 238.67 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-methoxy-2-methylbenzenesulfonyl fluoride is sourced from PubChem (CID 82292286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).