C12H16ClNO2 — CID 82293187
2-(3-chloro-4-ethoxyphenyl)morpholine (PubChem CID 82293187) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-(3-chloro-4-ethoxyphenyl)morpholine.
| Compound Name | 2-(3-chloro-4-ethoxyphenyl)morpholine |
|---|---|
| PubChem CID | 82293187 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-(3-chloro-4-ethoxyphenyl)morpholine |
| SMILES | CCOc1ccc(C2CNCCO2)cc1Cl |
| InChI | InChI=1S/C12H16ClNO2/c1-2-15-11-4-3-9(7-10(11)13)12-8-14-5-6-16-12/h3-4,7,12,14H,2,5-6,8H2,1H3 |
| InChIKey | QVNAGPNPJKBZIK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |