C10H12BrNO — CID 82293281
2-(2-bromophenyl)-1,3-oxazinane (PubChem CID 82293281) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1,3-oxazinane.
| Compound Name | 2-(2-bromophenyl)-1,3-oxazinane |
|---|---|
| PubChem CID | 82293281 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-(2-bromophenyl)-1,3-oxazinane |
| SMILES | Brc1ccccc1C1NCCCO1 |
| InChI | InChI=1S/C10H12BrNO/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5,10,12H,3,6-7H2 |
| InChIKey | ZDSXZAHXFVSDEM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |