3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid

C15H14O3 — CID 82293341

IUPAC3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid
SMILESCc1ccc(-c2cc(C(=O)O)ccc2O)c(C)c1
InChIInChI=1S/C15H14O3/c1-9-3-5-12(10(2)7-9)13-8-11(15(17)18)4-6-14(13)16/h3-8,16H,1-2H3,(H,17,18)
InChIKeyGJCPWLGFMVDSQX-UHFFFAOYSA-N
MW242.27 g/mol
LogP3.37
Rot. Bonds2

About 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid

3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid (PubChem CID 82293341) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid.

Molecular Properties

Compound Name3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid
PubChem CID82293341
Molecular FormulaC15H14O3
Molecular Weight242.27 g/mol
Exact Mass242.09
IUPAC Name3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid
SMILESCc1ccc(-c2cc(C(=O)O)ccc2O)c(C)c1
InChIInChI=1S/C15H14O3/c1-9-3-5-12(10(2)7-9)13-8-11(15(17)18)4-6-14(13)16/h3-8,16H,1-2H3,(H,17,18)
InChIKeyGJCPWLGFMVDSQX-UHFFFAOYSA-N
XLogP3.37
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.27
LogP ≤ 53.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid?
The IUPAC name of 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid (CID 82293341) is 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid.
What is the SMILES notation for 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid?
The canonical SMILES for 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid is Cc1ccc(-c2cc(C(=O)O)ccc2O)c(C)c1.
What is the InChIKey of 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid?
The InChIKey is GJCPWLGFMVDSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3/c1-9-3-5-12(10(2)7-9)13-8-11(15(17)18)4-6-14(13)16/h3-8,16H,1-2H3,(H,17,18).
What are the key properties of 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid?
3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid has a molecular weight of 242.27 g/mol, XLogP of 3.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylphenyl)-4-hydroxybenzoic acid is sourced from PubChem (CID 82293341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).