C14H14N2O2 — CID 82293374
4-(3,4-dimethylphenyl)-6-methylpyrimidine-5-carboxylic acid (PubChem CID 82293374) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-6-methylpyrimidine-5-carboxylic acid.
| Compound Name | 4-(3,4-dimethylphenyl)-6-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 82293374 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-6-methylpyrimidine-5-carboxylic acid |
| SMILES | Cc1ccc(-c2ncnc(C)c2C(=O)O)cc1C |
| InChI | InChI=1S/C14H14N2O2/c1-8-4-5-11(6-9(8)2)13-12(14(17)18)10(3)15-7-16-13/h4-7H,1-3H3,(H,17,18) |
| InChIKey | KIVRJCTULXLANF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |