About 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole
5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole (PubChem CID 822943) has the molecular formula C16H10F2N6
and a molecular weight of 324.29 g/mol. Its IUPAC name is 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole.
Molecular Properties
| Compound Name | 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole |
| PubChem CID | 822943 |
| Molecular Formula | C16H10F2N6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole |
| SMILES | Fc1ccc(-c2[nH]ncc2-c2nnnn2-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C16H10F2N6/c17-10-6-7-12(14(18)8-10)15-13(9-19-20-15)16-21-22-23-24(16)11-4-2-1-3-5-11/h1-9H,(H,19,20) |
| InChIKey | XPSBAKMKUGRJCM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole?
The IUPAC name of 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole (CID 822943) is 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole.
What is the SMILES notation for 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole?
The canonical SMILES for 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole is Fc1ccc(-c2[nH]ncc2-c2nnnn2-c2ccccc2)c(F)c1.
What is the InChIKey of 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole?
The InChIKey is XPSBAKMKUGRJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N6/c17-10-6-7-12(14(18)8-10)15-13(9-19-20-15)16-21-22-23-24(16)11-4-2-1-3-5-11/h1-9H,(H,19,20).
What are the key properties of 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole?
5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole has a molecular weight of 324.29 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]-1-phenyltetrazole is sourced from PubChem (CID 822943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).