C15H20N2O — CID 82294419
3,3-dimethyl-5-(2-methyl-1H-indol-3-yl)morpholine (PubChem CID 82294419) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 3,3-dimethyl-5-(2-methyl-1H-indol-3-yl)morpholine.
| Compound Name | 3,3-dimethyl-5-(2-methyl-1H-indol-3-yl)morpholine |
|---|---|
| PubChem CID | 82294419 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3,3-dimethyl-5-(2-methyl-1H-indol-3-yl)morpholine |
| SMILES | Cc1[nH]c2ccccc2c1C1COCC(C)(C)N1 |
| InChI | InChI=1S/C15H20N2O/c1-10-14(11-6-4-5-7-12(11)16-10)13-8-18-9-15(2,3)17-13/h4-7,13,16-17H,8-9H2,1-3H3 |
| InChIKey | RGTXVGCBAYQRHI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|