C11H17ClN2S — CID 82294535
1-[1-(5-chlorothiophen-2-yl)propyl]piperazine (PubChem CID 82294535) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)propyl]piperazine.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)propyl]piperazine |
|---|---|
| PubChem CID | 82294535 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)propyl]piperazine |
| SMILES | CCC(c1ccc(Cl)s1)N1CCNCC1 |
| InChI | InChI=1S/C11H17ClN2S/c1-2-9(10-3-4-11(12)15-10)14-7-5-13-6-8-14/h3-4,9,13H,2,5-8H2,1H3 |
| InChIKey | BEUBJYZKOXMYFY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |