C12H14N4O2 — CID 82295200
3-[2-(2,6-dimethylphenyl)tetrazol-5-yl]propanoic acid (PubChem CID 82295200) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylphenyl)tetrazol-5-yl]propanoic acid.
| Compound Name | 3-[2-(2,6-dimethylphenyl)tetrazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 82295200 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-[2-(2,6-dimethylphenyl)tetrazol-5-yl]propanoic acid |
| SMILES | Cc1cccc(C)c1-n1nnc(CCC(=O)O)n1 |
| InChI | InChI=1S/C12H14N4O2/c1-8-4-3-5-9(2)12(8)16-14-10(13-15-16)6-7-11(17)18/h3-5H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | VGWBJZHCZJNKKY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |