C16H25NO — CID 82295969
1-(4-methoxy-3-propan-2-ylphenyl)-N-methylcyclopentan-1-amine (PubChem CID 82295969) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-(4-methoxy-3-propan-2-ylphenyl)-N-methylcyclopentan-1-amine.
| Compound Name | 1-(4-methoxy-3-propan-2-ylphenyl)-N-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 82295969 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 1-(4-methoxy-3-propan-2-ylphenyl)-N-methylcyclopentan-1-amine |
| SMILES | CNC1(c2ccc(OC)c(C(C)C)c2)CCCC1 |
| InChI | InChI=1S/C16H25NO/c1-12(2)14-11-13(7-8-15(14)18-4)16(17-3)9-5-6-10-16/h7-8,11-12,17H,5-6,9-10H2,1-4H3 |
| InChIKey | FFXLWMQGIVQNQM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |