C15H20O3 — CID 82296372
cyclopentyl-(2,4-dimethoxy-3-methylphenyl)methanone (PubChem CID 82296372) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is cyclopentyl-(2,4-dimethoxy-3-methylphenyl)methanone.
| Compound Name | cyclopentyl-(2,4-dimethoxy-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 82296372 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | cyclopentyl-(2,4-dimethoxy-3-methylphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCCC2)c(OC)c1C |
| InChI | InChI=1S/C15H20O3/c1-10-13(17-2)9-8-12(15(10)18-3)14(16)11-6-4-5-7-11/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | OCXHHJOOISBMAY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |