About 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine
2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine (PubChem CID 82298475) has the molecular formula C14H20FNO2
and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine.
Molecular Properties
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine |
| PubChem CID | 82298475 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine |
| SMILES | COc1ccc(C2OCC(C)(C)NC2C)cc1F |
| InChI | InChI=1S/C14H20FNO2/c1-9-13(18-8-14(2,3)16-9)10-5-6-12(17-4)11(15)7-10/h5-7,9,13,16H,8H2,1-4H3 |
| InChIKey | NGZBIORGSAJDQB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine?
The IUPAC name of 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine (CID 82298475) is 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine.
What is the SMILES notation for 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine?
The canonical SMILES for 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine is COc1ccc(C2OCC(C)(C)NC2C)cc1F.
What is the InChIKey of 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine?
The InChIKey is NGZBIORGSAJDQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO2/c1-9-13(18-8-14(2,3)16-9)10-5-6-12(17-4)11(15)7-10/h5-7,9,13,16H,8H2,1-4H3.
What are the key properties of 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine?
2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine has a molecular weight of 253.32 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-4-methoxyphenyl)-3,5,5-trimethylmorpholine is sourced from PubChem (CID 82298475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).