C13H19NO2S — CID 82298549
2-(2,4,6-trimethylphenyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 82298549) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 2-(2,4,6-trimethylphenyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 82298549 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | Cc1cc(C)c(C2CNCCS2(=O)=O)c(C)c1 |
| InChI | InChI=1S/C13H19NO2S/c1-9-6-10(2)13(11(3)7-9)12-8-14-4-5-17(12,15)16/h6-7,12,14H,4-5,8H2,1-3H3 |
| InChIKey | RYKRTZFZVVVMHU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |