About 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine
5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine (PubChem CID 82298646) has the molecular formula C14H20ClNO
and a molecular weight of 253.77 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine |
| PubChem CID | 82298646 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCC(CCc2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C14H20ClNO/c1-14(2)10-17-9-13(16-14)8-5-11-3-6-12(15)7-4-11/h3-4,6-7,13,16H,5,8-10H2,1-2H3 |
| InChIKey | IKSOXFOLMZYVAU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine?
The IUPAC name of 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine (CID 82298646) is 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine.
What is the SMILES notation for 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine?
The canonical SMILES for 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine is CC1(C)COCC(CCc2ccc(Cl)cc2)N1.
What is the InChIKey of 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine?
The InChIKey is IKSOXFOLMZYVAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO/c1-14(2)10-17-9-13(16-14)8-5-11-3-6-12(15)7-4-11/h3-4,6-7,13,16H,5,8-10H2,1-2H3.
What are the key properties of 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine?
5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine has a molecular weight of 253.77 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-chlorophenyl)ethyl]-3,3-dimethylmorpholine is sourced from PubChem (CID 82298646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).