C14H12N2O3 — CID 82299508
4-(1,2-dimethylindol-3-yl)-1,3-oxazole-5-carboxylic acid (PubChem CID 82299508) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-(1,2-dimethylindol-3-yl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 4-(1,2-dimethylindol-3-yl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82299508 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-(1,2-dimethylindol-3-yl)-1,3-oxazole-5-carboxylic acid |
| SMILES | Cc1c(-c2ncoc2C(=O)O)c2ccccc2n1C |
| InChI | InChI=1S/C14H12N2O3/c1-8-11(12-13(14(17)18)19-7-15-12)9-5-3-4-6-10(9)16(8)2/h3-7H,1-2H3,(H,17,18) |
| InChIKey | BSVLVPYQCPTALE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |