About [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine
[1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine (PubChem CID 82300752) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine |
| PubChem CID | 82300752 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine |
| SMILES | Cc1ccc(C)c(C2(CN)CCN(C3CC3)CC2)c1 |
| InChI | InChI=1S/C17H26N2/c1-13-3-4-14(2)16(11-13)17(12-18)7-9-19(10-8-17)15-5-6-15/h3-4,11,15H,5-10,12,18H2,1-2H3 |
| InChIKey | INTYWRGXURHPTG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine?
The IUPAC name of [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine (CID 82300752) is [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine.
What is the SMILES notation for [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine?
The canonical SMILES for [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine is Cc1ccc(C)c(C2(CN)CCN(C3CC3)CC2)c1.
What is the InChIKey of [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine?
The InChIKey is INTYWRGXURHPTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2/c1-13-3-4-14(2)16(11-13)17(12-18)7-9-19(10-8-17)15-5-6-15/h3-4,11,15H,5-10,12,18H2,1-2H3.
What are the key properties of [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine?
[1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine has a molecular weight of 258.41 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyclopropyl-4-(2,5-dimethylphenyl)piperidin-4-yl]methanamine is sourced from PubChem (CID 82300752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).