About 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane
6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane (PubChem CID 82301345) has the molecular formula C12H15Cl2NO
and a molecular weight of 260.16 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane.
Molecular Properties
| Compound Name | 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane |
| PubChem CID | 82301345 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane |
| SMILES | Clc1ccc(CC2CNCCOC2)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c13-11-2-1-9(6-12(11)14)5-10-7-15-3-4-16-8-10/h1-2,6,10,15H,3-5,7-8H2 |
| InChIKey | JDENOINIFNDZNC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane?
The IUPAC name of 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane (CID 82301345) is 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane.
What is the SMILES notation for 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane?
The canonical SMILES for 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane is Clc1ccc(CC2CNCCOC2)cc1Cl.
What is the InChIKey of 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane?
The InChIKey is JDENOINIFNDZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO/c13-11-2-1-9(6-12(11)14)5-10-7-15-3-4-16-8-10/h1-2,6,10,15H,3-5,7-8H2.
What are the key properties of 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane?
6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane has a molecular weight of 260.16 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,4-dichlorophenyl)methyl]-1,4-oxazepane is sourced from PubChem (CID 82301345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).