C13H10F3N3 — CID 82304029
5-ethyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile (PubChem CID 82304029) has the molecular formula C13H10F3N3 and a molecular weight of 265.24 g/mol. Its IUPAC name is 5-ethyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile.
| Compound Name | 5-ethyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 82304029 |
| Molecular Formula | C13H10F3N3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 5-ethyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonitrile |
| SMILES | CCc1c(C#N)cnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3N3/c1-2-12-9(7-17)8-18-19(12)11-5-3-4-10(6-11)13(14,15)16/h3-6,8H,2H2,1H3 |
| InChIKey | CODYZAYWJMMBMA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |