C14H21ClN2O — CID 82305327
1-[(3-chloro-4-methoxyphenyl)methyl]-3,3-dimethylpiperazine (PubChem CID 82305327) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 1-[(3-chloro-4-methoxyphenyl)methyl]-3,3-dimethylpiperazine.
| Compound Name | 1-[(3-chloro-4-methoxyphenyl)methyl]-3,3-dimethylpiperazine |
|---|---|
| PubChem CID | 82305327 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-[(3-chloro-4-methoxyphenyl)methyl]-3,3-dimethylpiperazine |
| SMILES | COc1ccc(CN2CCNC(C)(C)C2)cc1Cl |
| InChI | InChI=1S/C14H21ClN2O/c1-14(2)10-17(7-6-16-14)9-11-4-5-13(18-3)12(15)8-11/h4-5,8,16H,6-7,9-10H2,1-3H3 |
| InChIKey | BXCXJVGQWLQPIQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |