About 7-(2-bromophenyl)-1,4-diazepan-5-one
7-(2-bromophenyl)-1,4-diazepan-5-one (PubChem CID 82305416) has the molecular formula C11H13BrN2O
and a molecular weight of 269.14 g/mol. Its IUPAC name is 7-(2-bromophenyl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 7-(2-bromophenyl)-1,4-diazepan-5-one |
| PubChem CID | 82305416 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 7-(2-bromophenyl)-1,4-diazepan-5-one |
| SMILES | O=C1CC(c2ccccc2Br)NCCN1 |
| InChI | InChI=1S/C11H13BrN2O/c12-9-4-2-1-3-8(9)10-7-11(15)14-6-5-13-10/h1-4,10,13H,5-7H2,(H,14,15) |
| InChIKey | DVWGLMLRNKFLEE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(2-bromophenyl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-bromophenyl)-1,4-diazepan-5-one?
The IUPAC name of 7-(2-bromophenyl)-1,4-diazepan-5-one (CID 82305416) is 7-(2-bromophenyl)-1,4-diazepan-5-one.
What is the SMILES notation for 7-(2-bromophenyl)-1,4-diazepan-5-one?
The canonical SMILES for 7-(2-bromophenyl)-1,4-diazepan-5-one is O=C1CC(c2ccccc2Br)NCCN1.
What is the InChIKey of 7-(2-bromophenyl)-1,4-diazepan-5-one?
The InChIKey is DVWGLMLRNKFLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN2O/c12-9-4-2-1-3-8(9)10-7-11(15)14-6-5-13-10/h1-4,10,13H,5-7H2,(H,14,15).
What are the key properties of 7-(2-bromophenyl)-1,4-diazepan-5-one?
7-(2-bromophenyl)-1,4-diazepan-5-one has a molecular weight of 269.14 g/mol, XLogP of 1.60, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-bromophenyl)-1,4-diazepan-5-one is sourced from PubChem (CID 82305416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).