About 5-(4-bromophenyl)-3,3-dimethylmorpholine
5-(4-bromophenyl)-3,3-dimethylmorpholine (PubChem CID 82305856) has the molecular formula C12H16BrNO
and a molecular weight of 270.17 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-3,3-dimethylmorpholine |
| PubChem CID | 82305856 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 5-(4-bromophenyl)-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCC(c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C12H16BrNO/c1-12(2)8-15-7-11(14-12)9-3-5-10(13)6-4-9/h3-6,11,14H,7-8H2,1-2H3 |
| InChIKey | QWWVLOZSEOGQEH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-bromophenyl)-3,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-3,3-dimethylmorpholine?
The IUPAC name of 5-(4-bromophenyl)-3,3-dimethylmorpholine (CID 82305856) is 5-(4-bromophenyl)-3,3-dimethylmorpholine.
What is the SMILES notation for 5-(4-bromophenyl)-3,3-dimethylmorpholine?
The canonical SMILES for 5-(4-bromophenyl)-3,3-dimethylmorpholine is CC1(C)COCC(c2ccc(Br)cc2)N1.
What is the InChIKey of 5-(4-bromophenyl)-3,3-dimethylmorpholine?
The InChIKey is QWWVLOZSEOGQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO/c1-12(2)8-15-7-11(14-12)9-3-5-10(13)6-4-9/h3-6,11,14H,7-8H2,1-2H3.
What are the key properties of 5-(4-bromophenyl)-3,3-dimethylmorpholine?
5-(4-bromophenyl)-3,3-dimethylmorpholine has a molecular weight of 270.17 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-3,3-dimethylmorpholine is sourced from PubChem (CID 82305856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).