C14H19ClO3 — CID 82306007
3-(5-chloro-2-methoxy-4-methylphenyl)-4-methylpentanoic acid (PubChem CID 82306007) has the molecular formula C14H19ClO3 and a molecular weight of 270.76 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxy-4-methylphenyl)-4-methylpentanoic acid.
| Compound Name | 3-(5-chloro-2-methoxy-4-methylphenyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82306007 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-(5-chloro-2-methoxy-4-methylphenyl)-4-methylpentanoic acid |
| SMILES | COc1cc(C)c(Cl)cc1C(CC(=O)O)C(C)C |
| InChI | InChI=1S/C14H19ClO3/c1-8(2)10(7-14(16)17)11-6-12(15)9(3)5-13(11)18-4/h5-6,8,10H,7H2,1-4H3,(H,16,17) |
| InChIKey | GLYJWDWPYXDCBR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |