C17H21NO2 — CID 82306158
(Z)-5,5-dimethyl-3-(2-methyl-1H-indol-3-yl)hex-2-enoic acid (PubChem CID 82306158) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (Z)-5,5-dimethyl-3-(2-methyl-1H-indol-3-yl)hex-2-enoic acid.
| Compound Name | (Z)-5,5-dimethyl-3-(2-methyl-1H-indol-3-yl)hex-2-enoic acid |
|---|---|
| PubChem CID | 82306158 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (Z)-5,5-dimethyl-3-(2-methyl-1H-indol-3-yl)hex-2-enoic acid |
| SMILES | Cc1[nH]c2ccccc2c1/C(=C\C(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C17H21NO2/c1-11-16(13-7-5-6-8-14(13)18-11)12(9-15(19)20)10-17(2,3)4/h5-9,18H,10H2,1-4H3,(H,19,20)/b12-9- |
| InChIKey | KIDAVMNQKPFQIW-XFXZXTDPSA-N |
| XLogP | 4.38 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|