C15H16N2O3 — CID 82306329
2-[4-(2-methoxy-3,5-dimethylphenyl)pyrimidin-5-yl]acetic acid (PubChem CID 82306329) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[4-(2-methoxy-3,5-dimethylphenyl)pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-(2-methoxy-3,5-dimethylphenyl)pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 82306329 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[4-(2-methoxy-3,5-dimethylphenyl)pyrimidin-5-yl]acetic acid |
| SMILES | COc1c(C)cc(C)cc1-c1ncncc1CC(=O)O |
| InChI | InChI=1S/C15H16N2O3/c1-9-4-10(2)15(20-3)12(5-9)14-11(6-13(18)19)7-16-8-17-14/h4-5,7-8H,6H2,1-3H3,(H,18,19) |
| InChIKey | BSFWXEMHYRVHGB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |