C13H13BrO2 — CID 82307300
(2E)-2-[3-(4-bromophenyl)cyclopentylidene]acetic acid (PubChem CID 82307300) has the molecular formula C13H13BrO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is (2E)-2-[3-(4-bromophenyl)cyclopentylidene]acetic acid.
| Compound Name | (2E)-2-[3-(4-bromophenyl)cyclopentylidene]acetic acid |
|---|---|
| PubChem CID | 82307300 |
| Molecular Formula | C13H13BrO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (2E)-2-[3-(4-bromophenyl)cyclopentylidene]acetic acid |
| SMILES | O=C(O)/C=C1\CCC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C13H13BrO2/c14-12-5-3-10(4-6-12)11-2-1-9(7-11)8-13(15)16/h3-6,8,11H,1-2,7H2,(H,15,16)/b9-8+ |
| InChIKey | QCNOMJPVZCNUFD-CMDGGOBGSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|