C11H11BrN2S — CID 82307426
2-[2-(2-bromophenyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 82307426) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 2-[2-(2-bromophenyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82307426 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 2-[2-(2-bromophenyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | NCCc1cnc(-c2ccccc2Br)s1 |
| InChI | InChI=1S/C11H11BrN2S/c12-10-4-2-1-3-9(10)11-14-7-8(15-11)5-6-13/h1-4,7H,5-6,13H2 |
| InChIKey | ZZYQVNFRAXUIPY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |