3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid

C12H11BrN2O2 — CID 82308012

IUPAC3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid
SMILESCc1nc(C)n(-c2cccc(Br)c2)c1C(=O)O
InChIInChI=1S/C12H11BrN2O2/c1-7-11(12(16)17)15(8(2)14-7)10-5-3-4-9(13)6-10/h3-6H,1-2H3,(H,16,17)
InChIKeyOOUAWNSVUCSFBA-UHFFFAOYSA-N
MW295.14 g/mol
LogP2.95
Rot. Bonds2

About 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid

3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid (PubChem CID 82308012) has the molecular formula C12H11BrN2O2 and a molecular weight of 295.14 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid.

Molecular Properties

Compound Name3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid
PubChem CID82308012
Molecular FormulaC12H11BrN2O2
Molecular Weight295.14 g/mol
Exact Mass294.00
IUPAC Name3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid
SMILESCc1nc(C)n(-c2cccc(Br)c2)c1C(=O)O
InChIInChI=1S/C12H11BrN2O2/c1-7-11(12(16)17)15(8(2)14-7)10-5-3-4-9(13)6-10/h3-6H,1-2H3,(H,16,17)
InChIKeyOOUAWNSVUCSFBA-UHFFFAOYSA-N
XLogP2.95
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.14
LogP ≤ 52.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid?
The IUPAC name of 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid (CID 82308012) is 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid.
What is the SMILES notation for 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid?
The canonical SMILES for 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid is Cc1nc(C)n(-c2cccc(Br)c2)c1C(=O)O.
What is the InChIKey of 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid?
The InChIKey is OOUAWNSVUCSFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrN2O2/c1-7-11(12(16)17)15(8(2)14-7)10-5-3-4-9(13)6-10/h3-6H,1-2H3,(H,16,17).
What are the key properties of 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid?
3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid has a molecular weight of 295.14 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-2,5-dimethylimidazole-4-carboxylic acid is sourced from PubChem (CID 82308012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).