About 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine
4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine (PubChem CID 82308797) has the molecular formula C8H3BrCl2N2S
and a molecular weight of 310.00 g/mol. Its IUPAC name is 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine.
Molecular Properties
| Compound Name | 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine |
| PubChem CID | 82308797 |
| Molecular Formula | C8H3BrCl2N2S |
| Molecular Weight | 310.00 g/mol |
| Exact Mass | 307.86 |
| IUPAC Name | 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine |
| SMILES | Clc1cc(-c2cc(Br)cs2)nc(Cl)n1 |
| InChI | InChI=1S/C8H3BrCl2N2S/c9-4-1-6(14-3-4)5-2-7(10)13-8(11)12-5/h1-3H |
| InChIKey | ZDLDGVLKEXUALA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.00 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine?
The IUPAC name of 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine (CID 82308797) is 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine.
What is the SMILES notation for 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine?
The canonical SMILES for 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine is Clc1cc(-c2cc(Br)cs2)nc(Cl)n1.
What is the InChIKey of 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine?
The InChIKey is ZDLDGVLKEXUALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrCl2N2S/c9-4-1-6(14-3-4)5-2-7(10)13-8(11)12-5/h1-3H.
What are the key properties of 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine?
4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine has a molecular weight of 310.00 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromothiophen-2-yl)-2,6-dichloropyrimidine is sourced from PubChem (CID 82308797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).