C12H10BrNO2S — CID 82308937
1-[4-(5-bromo-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanone (PubChem CID 82308937) has the molecular formula C12H10BrNO2S and a molecular weight of 312.19 g/mol. Its IUPAC name is 1-[4-(5-bromo-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 1-[4-(5-bromo-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 82308937 |
| Molecular Formula | C12H10BrNO2S |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | 1-[4-(5-bromo-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanone |
| SMILES | COc1ccc(Br)cc1-c1csc(C(C)=O)n1 |
| InChI | InChI=1S/C12H10BrNO2S/c1-7(15)12-14-10(6-17-12)9-5-8(13)3-4-11(9)16-2/h3-6H,1-2H3 |
| InChIKey | MEKVJGDESMBSSO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |