About N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine
N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 82309488) has the molecular formula C12H16ClN3S
and a molecular weight of 269.80 g/mol. Its IUPAC name is N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
| PubChem CID | 82309488 |
| Molecular Formula | C12H16ClN3S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCC(C)Nc1nc(Cl)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C12H16ClN3S/c1-5-6(2)14-12-15-10(13)9-7(3)8(4)17-11(9)16-12/h6H,5H2,1-4H3,(H,14,15,16) |
| InChIKey | MKNGOKYQDSUDKT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine?
The IUPAC name of N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine (CID 82309488) is N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine?
The canonical SMILES for N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine is CCC(C)Nc1nc(Cl)c2c(C)c(C)sc2n1.
What is the InChIKey of N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine?
The InChIKey is MKNGOKYQDSUDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN3S/c1-5-6(2)14-12-15-10(13)9-7(3)8(4)17-11(9)16-12/h6H,5H2,1-4H3,(H,14,15,16).
What are the key properties of N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine?
N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine has a molecular weight of 269.80 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 82309488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).