C16H25FN4 — CID 82310769
N-[[1-(3-aminopropyl)-5-fluorobenzimidazol-2-yl]methyl]-N-methylbutan-1-amine (PubChem CID 82310769) has the molecular formula C16H25FN4 and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[[1-(3-aminopropyl)-5-fluorobenzimidazol-2-yl]methyl]-N-methylbutan-1-amine.
| Compound Name | N-[[1-(3-aminopropyl)-5-fluorobenzimidazol-2-yl]methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 82310769 |
| Molecular Formula | C16H25FN4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | N-[[1-(3-aminopropyl)-5-fluorobenzimidazol-2-yl]methyl]-N-methylbutan-1-amine |
| SMILES | CCCCN(C)Cc1nc2cc(F)ccc2n1CCCN |
| InChI | InChI=1S/C16H25FN4/c1-3-4-9-20(2)12-16-19-14-11-13(17)6-7-15(14)21(16)10-5-8-18/h6-7,11H,3-5,8-10,12,18H2,1-2H3 |
| InChIKey | JCAYYTMZVQNYIC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |