C13H16N4O — CID 82311201
2-[2-[(dimethylamino)methyl]-5-methoxybenzimidazol-1-yl]acetonitrile (PubChem CID 82311201) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]-5-methoxybenzimidazol-1-yl]acetonitrile.
| Compound Name | 2-[2-[(dimethylamino)methyl]-5-methoxybenzimidazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 82311201 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]-5-methoxybenzimidazol-1-yl]acetonitrile |
| SMILES | COc1ccc2c(c1)nc(CN(C)C)n2CC#N |
| InChI | InChI=1S/C13H16N4O/c1-16(2)9-13-15-11-8-10(18-3)4-5-12(11)17(13)7-6-14/h4-5,8H,7,9H2,1-3H3 |
| InChIKey | CCCTZEOXONHQPZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |