C14H17FN4 — CID 82311236
2-[2-[1-(dimethylamino)propyl]-5-fluorobenzimidazol-1-yl]acetonitrile (PubChem CID 82311236) has the molecular formula C14H17FN4 and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-[2-[1-(dimethylamino)propyl]-5-fluorobenzimidazol-1-yl]acetonitrile.
| Compound Name | 2-[2-[1-(dimethylamino)propyl]-5-fluorobenzimidazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 82311236 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-[2-[1-(dimethylamino)propyl]-5-fluorobenzimidazol-1-yl]acetonitrile |
| SMILES | CCC(c1nc2cc(F)ccc2n1CC#N)N(C)C |
| InChI | InChI=1S/C14H17FN4/c1-4-12(18(2)3)14-17-11-9-10(15)5-6-13(11)19(14)8-7-16/h5-6,9,12H,4,8H2,1-3H3 |
| InChIKey | GGUCEMSKWPATTC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |