C17H29NO2 — CID 82312760
1-(4-ethylphenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]-3-methylbutan-1-ol (PubChem CID 82312760) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]-3-methylbutan-1-ol.
| Compound Name | 1-(4-ethylphenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 82312760 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-(4-ethylphenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]-3-methylbutan-1-ol |
| SMILES | CCc1ccc(C(O)C(NC(C)(C)CO)C(C)C)cc1 |
| InChI | InChI=1S/C17H29NO2/c1-6-13-7-9-14(10-8-13)16(20)15(12(2)3)18-17(4,5)11-19/h7-10,12,15-16,18-20H,6,11H2,1-5H3 |
| InChIKey | NGRAYSLLNBBUJQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |