C13H18FNO4 — CID 82315016
2-[[2-(4-fluoro-3-methylphenyl)-2-hydroxyethyl]amino]-3-hydroxybutanoic acid (PubChem CID 82315016) has the molecular formula C13H18FNO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-[[2-(4-fluoro-3-methylphenyl)-2-hydroxyethyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-(4-fluoro-3-methylphenyl)-2-hydroxyethyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 82315016 |
| Molecular Formula | C13H18FNO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[[2-(4-fluoro-3-methylphenyl)-2-hydroxyethyl]amino]-3-hydroxybutanoic acid |
| SMILES | Cc1cc(C(O)CNC(C(=O)O)C(C)O)ccc1F |
| InChI | InChI=1S/C13H18FNO4/c1-7-5-9(3-4-10(7)14)11(17)6-15-12(8(2)16)13(18)19/h3-5,8,11-12,15-17H,6H2,1-2H3,(H,18,19) |
| InChIKey | LOUBNCZIZVXPLS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |