3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid

C17H17F2NO2 — CID 82317344

IUPAC3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid
SMILESCC(CN(Cc1ccccc1)c1ccc(F)cc1F)C(=O)O
InChIInChI=1S/C17H17F2NO2/c1-12(17(21)22)10-20(11-13-5-3-2-4-6-13)16-8-7-14(18)9-15(16)19/h2-9,12H,10-11H2,1H3,(H,21,22)
InChIKeyDAULTDXSOVJXQO-UHFFFAOYSA-N
MW305.32 g/mol
LogP3.69
Rot. Bonds6

About 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid

3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid (PubChem CID 82317344) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid
PubChem CID82317344
Molecular FormulaC17H17F2NO2
Molecular Weight305.32 g/mol
Exact Mass305.12
IUPAC Name3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid
SMILESCC(CN(Cc1ccccc1)c1ccc(F)cc1F)C(=O)O
InChIInChI=1S/C17H17F2NO2/c1-12(17(21)22)10-20(11-13-5-3-2-4-6-13)16-8-7-14(18)9-15(16)19/h2-9,12H,10-11H2,1H3,(H,21,22)
InChIKeyDAULTDXSOVJXQO-UHFFFAOYSA-N
XLogP3.69
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.32
LogP ≤ 53.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid?
The IUPAC name of 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid (CID 82317344) is 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid.
What is the SMILES notation for 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid?
The canonical SMILES for 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid is CC(CN(Cc1ccccc1)c1ccc(F)cc1F)C(=O)O.
What is the InChIKey of 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid?
The InChIKey is DAULTDXSOVJXQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO2/c1-12(17(21)22)10-20(11-13-5-3-2-4-6-13)16-8-7-14(18)9-15(16)19/h2-9,12H,10-11H2,1H3,(H,21,22).
What are the key properties of 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid?
3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid has a molecular weight of 305.32 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(N-benzyl-2,4-difluoroanilino)-2-methylpropanoic acid is sourced from PubChem (CID 82317344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).