C18H20FNO2 — CID 82317455
3-[N-[(2-fluorophenyl)methyl]-2,6-dimethylanilino]propanoic acid (PubChem CID 82317455) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is 3-[N-[(2-fluorophenyl)methyl]-2,6-dimethylanilino]propanoic acid.
| Compound Name | 3-[N-[(2-fluorophenyl)methyl]-2,6-dimethylanilino]propanoic acid |
|---|---|
| PubChem CID | 82317455 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-[N-[(2-fluorophenyl)methyl]-2,6-dimethylanilino]propanoic acid |
| SMILES | Cc1cccc(C)c1N(CCC(=O)O)Cc1ccccc1F |
| InChI | InChI=1S/C18H20FNO2/c1-13-6-5-7-14(2)18(13)20(11-10-17(21)22)12-15-8-3-4-9-16(15)19/h3-9H,10-12H2,1-2H3,(H,21,22) |
| InChIKey | YAGAGCQCOJZNAT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |