C17H25NO2 — CID 82319541
3-[4-butyl-N-(2-methylprop-2-enyl)anilino]propanoic acid (PubChem CID 82319541) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-[4-butyl-N-(2-methylprop-2-enyl)anilino]propanoic acid.
| Compound Name | 3-[4-butyl-N-(2-methylprop-2-enyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 82319541 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-[4-butyl-N-(2-methylprop-2-enyl)anilino]propanoic acid |
| SMILES | C=C(C)CN(CCC(=O)O)c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C17H25NO2/c1-4-5-6-15-7-9-16(10-8-15)18(13-14(2)3)12-11-17(19)20/h7-10H,2,4-6,11-13H2,1,3H3,(H,19,20) |
| InChIKey | DGKGWBGDOAJUPA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|