C14H22N2O2 — CID 82319994
3-[N-[3-(dimethylamino)propyl]anilino]propanoic acid (PubChem CID 82319994) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-[N-[3-(dimethylamino)propyl]anilino]propanoic acid.
| Compound Name | 3-[N-[3-(dimethylamino)propyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 82319994 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-[N-[3-(dimethylamino)propyl]anilino]propanoic acid |
| SMILES | CN(C)CCCN(CCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H22N2O2/c1-15(2)10-6-11-16(12-9-14(17)18)13-7-4-3-5-8-13/h3-5,7-8H,6,9-12H2,1-2H3,(H,17,18) |
| InChIKey | HZXRTXCEBXVZAJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |